C20H20N4O — CID 130430725
4-(4-cyanophenyl)-6-[(2-hydroxy-2-methylpropyl)amino]-1,3-dihydroisoindole-2-carbonitrile (PubChem CID 130430725) has the molecular formula C20H20N4O and a molecular weight of 332.41 g/mol. Its IUPAC name is 4-(4-cyanophenyl)-6-[(2-hydroxy-2-methylpropyl)amino]-1,3-dihydroisoindole-2-carbonitrile.
| Compound Name | 4-(4-cyanophenyl)-6-[(2-hydroxy-2-methylpropyl)amino]-1,3-dihydroisoindole-2-carbonitrile |
|---|---|
| PubChem CID | 130430725 |
| Molecular Formula | C20H20N4O |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | 4-(4-cyanophenyl)-6-[(2-hydroxy-2-methylpropyl)amino]-1,3-dihydroisoindole-2-carbonitrile |
| SMILES | CC(C)(O)CNc1cc2c(c(-c3ccc(C#N)cc3)c1)CN(C#N)C2 |
| InChI | InChI=1S/C20H20N4O/c1-20(2,25)12-23-17-7-16-10-24(13-22)11-19(16)18(8-17)15-5-3-14(9-21)4-6-15/h3-8,23,25H,10-12H2,1-2H3 |
| InChIKey | AJBWTJBCNGUJOV-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 83.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|