C18H18FN3O2 — CID 130430399
6-[[(2S)-2,3-dihydroxypropyl]amino]-4-(4-fluorophenyl)-1,3-dihydroisoindole-2-carbonitrile (PubChem CID 130430399) has the molecular formula C18H18FN3O2 and a molecular weight of 327.36 g/mol. Its IUPAC name is 6-[[(2S)-2,3-dihydroxypropyl]amino]-4-(4-fluorophenyl)-1,3-dihydroisoindole-2-carbonitrile.
| Compound Name | 6-[[(2S)-2,3-dihydroxypropyl]amino]-4-(4-fluorophenyl)-1,3-dihydroisoindole-2-carbonitrile |
|---|---|
| PubChem CID | 130430399 |
| Molecular Formula | C18H18FN3O2 |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 6-[[(2S)-2,3-dihydroxypropyl]amino]-4-(4-fluorophenyl)-1,3-dihydroisoindole-2-carbonitrile |
| SMILES | N#CN1Cc2cc(NC[C@H](O)CO)cc(-c3ccc(F)cc3)c2C1 |
| InChI | InChI=1S/C18H18FN3O2/c19-14-3-1-12(2-4-14)17-6-15(21-7-16(24)10-23)5-13-8-22(11-20)9-18(13)17/h1-6,16,21,23-24H,7-10H2/t16-/m0/s1 |
| InChIKey | WUKOAYJVDRSWSC-INIZCTEOSA-N |
| XLogP | 2.05 |
| TPSA | 79.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|