C21H18F3NO2 — CID 130432758
methyl 1-cyclopropyl-2-[[4-(trifluoromethyl)phenyl]methyl]indole-5-carboxylate (PubChem CID 130432758) has the molecular formula C21H18F3NO2 and a molecular weight of 373.37 g/mol. Its IUPAC name is methyl 1-cyclopropyl-2-[[4-(trifluoromethyl)phenyl]methyl]indole-5-carboxylate.
| Compound Name | methyl 1-cyclopropyl-2-[[4-(trifluoromethyl)phenyl]methyl]indole-5-carboxylate |
|---|---|
| PubChem CID | 130432758 |
| Molecular Formula | C21H18F3NO2 |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | methyl 1-cyclopropyl-2-[[4-(trifluoromethyl)phenyl]methyl]indole-5-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)cc(Cc1ccc(C(F)(F)F)cc1)n2C1CC1 |
| InChI | InChI=1S/C21H18F3NO2/c1-27-20(26)14-4-9-19-15(11-14)12-18(25(19)17-7-8-17)10-13-2-5-16(6-3-13)21(22,23)24/h2-6,9,11-12,17H,7-8,10H2,1H3 |
| InChIKey | DZJVSLPTQSKOPL-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |