C20H21F3O4 — CID 159023275
1,4-dioxane;methyl 4-[[4-(trifluoromethyl)phenyl]methyl]benzoate (PubChem CID 159023275) has the molecular formula C20H21F3O4 and a molecular weight of 382.38 g/mol. Its IUPAC name is 1,4-dioxane;methyl 4-[[4-(trifluoromethyl)phenyl]methyl]benzoate.
| Compound Name | 1,4-dioxane;methyl 4-[[4-(trifluoromethyl)phenyl]methyl]benzoate |
|---|---|
| PubChem CID | 159023275 |
| Molecular Formula | C20H21F3O4 |
| Molecular Weight | 382.38 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 1,4-dioxane;methyl 4-[[4-(trifluoromethyl)phenyl]methyl]benzoate |
| SMILES | C1COCCO1.COC(=O)c1ccc(Cc2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C16H13F3O2.C4H8O2/c1-21-15(20)13-6-2-11(3-7-13)10-12-4-8-14(9-5-12)16(17,18)19;1-2-6-4-3-5-1/h2-9H,10H2,1H3;1-4H2 |
| InChIKey | JTYVYXURTUBHAH-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.38 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |