C17H14N2O3S — CID 130433117
(E)-5-[4-(benzenesulfinamido)phenyl]-N-hydroxypent-2-en-4-ynamide (PubChem CID 130433117) has the molecular formula C17H14N2O3S and a molecular weight of 326.38 g/mol. Its IUPAC name is (E)-5-[4-(benzenesulfinamido)phenyl]-N-hydroxypent-2-en-4-ynamide.
| Compound Name | (E)-5-[4-(benzenesulfinamido)phenyl]-N-hydroxypent-2-en-4-ynamide |
|---|---|
| PubChem CID | 130433117 |
| Molecular Formula | C17H14N2O3S |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | (E)-5-[4-(benzenesulfinamido)phenyl]-N-hydroxypent-2-en-4-ynamide |
| SMILES | O=C(/C=C/C#Cc1ccc(NS(=O)c2ccccc2)cc1)NO |
| InChI | InChI=1S/C17H14N2O3S/c20-17(18-21)9-5-4-6-14-10-12-15(13-11-14)19-23(22)16-7-2-1-3-8-16/h1-3,5,7-13,19,21H,(H,18,20)/b9-5+ |
| InChIKey | AJSAURACYMHUTC-WEVVVXLNSA-N |
| XLogP | 2.23 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|