C17H19NO3 — CID 23092232
6-[[(E)-5-phenylpent-2-en-4-ynoyl]amino]hexanoic acid (PubChem CID 23092232) has the molecular formula C17H19NO3 and a molecular weight of 285.34 g/mol. Its IUPAC name is 6-[[(E)-5-phenylpent-2-en-4-ynoyl]amino]hexanoic acid.
| Compound Name | 6-[[(E)-5-phenylpent-2-en-4-ynoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 23092232 |
| Molecular Formula | C17H19NO3 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | 6-[[(E)-5-phenylpent-2-en-4-ynoyl]amino]hexanoic acid |
| SMILES | O=C(O)CCCCCNC(=O)/C=C/C#Cc1ccccc1 |
| InChI | InChI=1S/C17H19NO3/c19-16(18-14-8-2-5-13-17(20)21)12-7-6-11-15-9-3-1-4-10-15/h1,3-4,7,9-10,12H,2,5,8,13-14H2,(H,18,19)(H,20,21)/b12-7+ |
| InChIKey | QAERAUCIQWCEIW-KPKJPENVSA-N |
| XLogP | 2.36 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|