C5H5F5N4 — CID 130433476
2-methyl-5-(1,1,3,3,3-pentafluoropropyl)tetrazole (PubChem CID 130433476) has the molecular formula C5H5F5N4 and a molecular weight of 216.11 g/mol. Its IUPAC name is 2-methyl-5-(1,1,3,3,3-pentafluoropropyl)tetrazole.
| Compound Name | 2-methyl-5-(1,1,3,3,3-pentafluoropropyl)tetrazole |
|---|---|
| PubChem CID | 130433476 |
| Molecular Formula | C5H5F5N4 |
| Molecular Weight | 216.11 g/mol |
| Exact Mass | 216.04 |
| IUPAC Name | 2-methyl-5-(1,1,3,3,3-pentafluoropropyl)tetrazole |
| SMILES | Cn1nnc(C(F)(F)CC(F)(F)F)n1 |
| InChI | InChI=1S/C5H5F5N4/c1-14-12-3(11-13-14)4(6,7)2-5(8,9)10/h2H2,1H3 |
| InChIKey | JTJDJNUMFPMRKX-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.11 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |