C19H23N5 — CID 125485908
(2R)-N-methyl-4-(2-methyltetrazol-5-yl)-4,4-diphenylbutan-2-amine (PubChem CID 125485908) has the molecular formula C19H23N5 and a molecular weight of 321.43 g/mol. Its IUPAC name is (2R)-N-methyl-4-(2-methyltetrazol-5-yl)-4,4-diphenylbutan-2-amine.
| Compound Name | (2R)-N-methyl-4-(2-methyltetrazol-5-yl)-4,4-diphenylbutan-2-amine |
|---|---|
| PubChem CID | 125485908 |
| Molecular Formula | C19H23N5 |
| Molecular Weight | 321.43 g/mol |
| Exact Mass | 321.20 |
| IUPAC Name | (2R)-N-methyl-4-(2-methyltetrazol-5-yl)-4,4-diphenylbutan-2-amine |
| SMILES | CN[C@H](C)CC(c1ccccc1)(c1ccccc1)c1nnn(C)n1 |
| InChI | InChI=1S/C19H23N5/c1-15(20-2)14-19(16-10-6-4-7-11-16,17-12-8-5-9-13-17)18-21-23-24(3)22-18/h4-13,15,20H,14H2,1-3H3/t15-/m1/s1 |
| InChIKey | PNLQEDRNYUIQRS-OAHLLOKOSA-N |
| XLogP | 2.54 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.43 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |