C15H11N5S — CID 130434539
3-naphthalen-1-ylsulfanyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 130434539) has the molecular formula C15H11N5S and a molecular weight of 293.36 g/mol. Its IUPAC name is 3-naphthalen-1-ylsulfanyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 3-naphthalen-1-ylsulfanyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 130434539 |
| Molecular Formula | C15H11N5S |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 3-naphthalen-1-ylsulfanyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | Nc1ncnc2[nH]nc(Sc3cccc4ccccc34)c12 |
| InChI | InChI=1S/C15H11N5S/c16-13-12-14(18-8-17-13)19-20-15(12)21-11-7-3-5-9-4-1-2-6-10(9)11/h1-8H,(H3,16,17,18,19,20) |
| InChIKey | FSMBTCCTKFCFEG-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |