About naphthalen-1-yl thiohypofluorite
naphthalen-1-yl thiohypofluorite (PubChem CID 142394158) has the molecular formula C10H7FS
and a molecular weight of 178.23 g/mol. Its IUPAC name is naphthalen-1-yl thiohypofluorite.
Molecular Properties
| Compound Name | naphthalen-1-yl thiohypofluorite |
| PubChem CID | 142394158 |
| Molecular Formula | C10H7FS |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.03 |
| IUPAC Name | naphthalen-1-yl thiohypofluorite |
| SMILES | FSc1cccc2ccccc12 |
| InChI | InChI=1S/C10H7FS/c11-12-10-7-3-5-8-4-1-2-6-9(8)10/h1-7H |
| InChIKey | PJZLZUXXOAFTTB-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze naphthalen-1-yl thiohypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalen-1-yl thiohypofluorite?
The IUPAC name of naphthalen-1-yl thiohypofluorite (CID 142394158) is naphthalen-1-yl thiohypofluorite.
What is the SMILES notation for naphthalen-1-yl thiohypofluorite?
The canonical SMILES for naphthalen-1-yl thiohypofluorite is FSc1cccc2ccccc12.
What is the InChIKey of naphthalen-1-yl thiohypofluorite?
The InChIKey is PJZLZUXXOAFTTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7FS/c11-12-10-7-3-5-8-4-1-2-6-9(8)10/h1-7H.
What are the key properties of naphthalen-1-yl thiohypofluorite?
naphthalen-1-yl thiohypofluorite has a molecular weight of 178.23 g/mol, XLogP of 3.82, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalen-1-yl thiohypofluorite is sourced from PubChem (CID 142394158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).