About naphthalen-1-ylsulfanyl chlorate
naphthalen-1-ylsulfanyl chlorate (PubChem CID 170558441) has the molecular formula C10H7ClO3S
and a molecular weight of 242.68 g/mol. Its IUPAC name is naphthalen-1-ylsulfanyl chlorate.
Molecular Properties
| Compound Name | naphthalen-1-ylsulfanyl chlorate |
| PubChem CID | 170558441 |
| Molecular Formula | C10H7ClO3S |
| Molecular Weight | 242.68 g/mol |
| Exact Mass | 241.98 |
| IUPAC Name | naphthalen-1-ylsulfanyl chlorate |
| SMILES | [O-][Cl+2]([O-])OSc1cccc2ccccc12 |
| InChI | InChI=1S/C10H7ClO3S/c12-11(13)14-15-10-7-3-5-8-4-1-2-6-9(8)10/h1-7H |
| InChIKey | OVKKFKRDYXBNNR-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 55.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.68 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze naphthalen-1-ylsulfanyl chlorate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalen-1-ylsulfanyl chlorate?
The IUPAC name of naphthalen-1-ylsulfanyl chlorate (CID 170558441) is naphthalen-1-ylsulfanyl chlorate.
What is the SMILES notation for naphthalen-1-ylsulfanyl chlorate?
The canonical SMILES for naphthalen-1-ylsulfanyl chlorate is [O-][Cl+2]([O-])OSc1cccc2ccccc12.
What is the InChIKey of naphthalen-1-ylsulfanyl chlorate?
The InChIKey is OVKKFKRDYXBNNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7ClO3S/c12-11(13)14-15-10-7-3-5-8-4-1-2-6-9(8)10/h1-7H.
What are the key properties of naphthalen-1-ylsulfanyl chlorate?
naphthalen-1-ylsulfanyl chlorate has a molecular weight of 242.68 g/mol, XLogP of 0.95, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalen-1-ylsulfanyl chlorate is sourced from PubChem (CID 170558441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).