About naphthalen-1-ylsulfanyl N-carbamoylcarbamate
naphthalen-1-ylsulfanyl N-carbamoylcarbamate (PubChem CID 68502608) has the molecular formula C12H10N2O3S
and a molecular weight of 262.29 g/mol. Its IUPAC name is naphthalen-1-ylsulfanyl N-carbamoylcarbamate.
Molecular Properties
| Compound Name | naphthalen-1-ylsulfanyl N-carbamoylcarbamate |
| PubChem CID | 68502608 |
| Molecular Formula | C12H10N2O3S |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.04 |
| IUPAC Name | naphthalen-1-ylsulfanyl N-carbamoylcarbamate |
| SMILES | NC(=O)NC(=O)OSc1cccc2ccccc12 |
| InChI | InChI=1S/C12H10N2O3S/c13-11(15)14-12(16)17-18-10-7-3-5-8-4-1-2-6-9(8)10/h1-7H,(H3,13,14,15,16) |
| InChIKey | SPQABEARCGPJDX-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze naphthalen-1-ylsulfanyl N-carbamoylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalen-1-ylsulfanyl N-carbamoylcarbamate?
The IUPAC name of naphthalen-1-ylsulfanyl N-carbamoylcarbamate (CID 68502608) is naphthalen-1-ylsulfanyl N-carbamoylcarbamate.
What is the SMILES notation for naphthalen-1-ylsulfanyl N-carbamoylcarbamate?
The canonical SMILES for naphthalen-1-ylsulfanyl N-carbamoylcarbamate is NC(=O)NC(=O)OSc1cccc2ccccc12.
What is the InChIKey of naphthalen-1-ylsulfanyl N-carbamoylcarbamate?
The InChIKey is SPQABEARCGPJDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2O3S/c13-11(15)14-12(16)17-18-10-7-3-5-8-4-1-2-6-9(8)10/h1-7H,(H3,13,14,15,16).
What are the key properties of naphthalen-1-ylsulfanyl N-carbamoylcarbamate?
naphthalen-1-ylsulfanyl N-carbamoylcarbamate has a molecular weight of 262.29 g/mol, XLogP of 2.65, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalen-1-ylsulfanyl N-carbamoylcarbamate is sourced from PubChem (CID 68502608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).