C16H20N3O2+ — CID 8695317
[(2R)-1-(carbamoylamino)-1-oxopropan-2-yl]-[(1R)-1-naphthalen-1-ylethyl]azanium (PubChem CID 8695317) has the molecular formula C16H20N3O2+ and a molecular weight of 286.36 g/mol. Its IUPAC name is [(2R)-1-(carbamoylamino)-1-oxopropan-2-yl]-[(1R)-1-naphthalen-1-ylethyl]azanium.
| Compound Name | [(2R)-1-(carbamoylamino)-1-oxopropan-2-yl]-[(1R)-1-naphthalen-1-ylethyl]azanium |
|---|---|
| PubChem CID | 8695317 |
| Molecular Formula | C16H20N3O2+ |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | [(2R)-1-(carbamoylamino)-1-oxopropan-2-yl]-[(1R)-1-naphthalen-1-ylethyl]azanium |
| SMILES | C[C@@H]([NH2+][C@H](C)c1cccc2ccccc12)C(=O)NC(N)=O |
| InChI | InChI=1S/C16H19N3O2/c1-10(18-11(2)15(20)19-16(17)21)13-9-5-7-12-6-3-4-8-14(12)13/h3-11,18H,1-2H3,(H3,17,19,20,21)/p+1/t10-,11-/m1/s1 |
| InChIKey | BZVQPURRMGIBAY-GHMZBOCLSA-O |
| XLogP | 1.05 |
| TPSA | 88.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |