C18H25N2O+ — CID 8695425
[(1S)-1-naphthalen-1-ylethyl]-[(2S)-1-oxo-1-(propan-2-ylamino)propan-2-yl]azanium (PubChem CID 8695425) has the molecular formula C18H25N2O+ and a molecular weight of 285.41 g/mol. Its IUPAC name is [(1S)-1-naphthalen-1-ylethyl]-[(2S)-1-oxo-1-(propan-2-ylamino)propan-2-yl]azanium.
| Compound Name | [(1S)-1-naphthalen-1-ylethyl]-[(2S)-1-oxo-1-(propan-2-ylamino)propan-2-yl]azanium |
|---|---|
| PubChem CID | 8695425 |
| Molecular Formula | C18H25N2O+ |
| Molecular Weight | 285.41 g/mol |
| Exact Mass | 285.20 |
| IUPAC Name | [(1S)-1-naphthalen-1-ylethyl]-[(2S)-1-oxo-1-(propan-2-ylamino)propan-2-yl]azanium |
| SMILES | CC(C)NC(=O)[C@H](C)[NH2+][C@@H](C)c1cccc2ccccc12 |
| InChI | InChI=1S/C18H24N2O/c1-12(2)19-18(21)14(4)20-13(3)16-11-7-9-15-8-5-6-10-17(15)16/h5-14,20H,1-4H3,(H,19,21)/p+1/t13-,14-/m0/s1 |
| InChIKey | ISUMJFHILVVUFS-KBPBESRZSA-O |
| XLogP | 2.38 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.41 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |