C22H22N3O+ — CID 135809561
[(1R)-1-naphthalen-1-ylethyl]-[(1S)-1-(4-oxo-3H-quinazolin-2-yl)ethyl]azanium (PubChem CID 135809561) has the molecular formula C22H22N3O+ and a molecular weight of 344.44 g/mol. Its IUPAC name is [(1R)-1-naphthalen-1-ylethyl]-[(1S)-1-(4-oxo-3H-quinazolin-2-yl)ethyl]azanium.
| Compound Name | [(1R)-1-naphthalen-1-ylethyl]-[(1S)-1-(4-oxo-3H-quinazolin-2-yl)ethyl]azanium |
|---|---|
| PubChem CID | 135809561 |
| Molecular Formula | C22H22N3O+ |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | [(1R)-1-naphthalen-1-ylethyl]-[(1S)-1-(4-oxo-3H-quinazolin-2-yl)ethyl]azanium |
| SMILES | C[C@H]([NH2+][C@H](C)c1cccc2ccccc12)c1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C22H21N3O/c1-14(17-12-7-9-16-8-3-4-10-18(16)17)23-15(2)21-24-20-13-6-5-11-19(20)22(26)25-21/h3-15,23H,1-2H3,(H,24,25,26)/p+1/t14-,15+/m1/s1 |
| InChIKey | VNANJZFVSMHIOC-CABCVRRESA-O |
| XLogP | 3.46 |
| TPSA | 62.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |