C21H20N3OS+ — CID 135722504
[(1S)-1-(4-oxo-3H-quinazolin-2-yl)ethyl]-[(R)-phenyl(thiophen-2-yl)methyl]azanium (PubChem CID 135722504) has the molecular formula C21H20N3OS+ and a molecular weight of 362.48 g/mol. Its IUPAC name is [(1S)-1-(4-oxo-3H-quinazolin-2-yl)ethyl]-[(R)-phenyl(thiophen-2-yl)methyl]azanium.
| Compound Name | [(1S)-1-(4-oxo-3H-quinazolin-2-yl)ethyl]-[(R)-phenyl(thiophen-2-yl)methyl]azanium |
|---|---|
| PubChem CID | 135722504 |
| Molecular Formula | C21H20N3OS+ |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | [(1S)-1-(4-oxo-3H-quinazolin-2-yl)ethyl]-[(R)-phenyl(thiophen-2-yl)methyl]azanium |
| SMILES | C[C@H]([NH2+][C@H](c1ccccc1)c1cccs1)c1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C21H19N3OS/c1-14(20-23-17-11-6-5-10-16(17)21(25)24-20)22-19(18-12-7-13-26-18)15-8-3-2-4-9-15/h2-14,19,22H,1H3,(H,23,24,25)/p+1/t14-,19+/m0/s1 |
| InChIKey | UAGWYCQITNMCMW-IFXJQAMLSA-O |
| XLogP | 3.40 |
| TPSA | 62.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |