C24H24N3O2+ — CID 135677079
[(R)-(4-methoxyphenyl)-phenylmethyl]-[(1S)-1-(4-oxo-3H-quinazolin-2-yl)ethyl]azanium (PubChem CID 135677079) has the molecular formula C24H24N3O2+ and a molecular weight of 386.48 g/mol. Its IUPAC name is [(R)-(4-methoxyphenyl)-phenylmethyl]-[(1S)-1-(4-oxo-3H-quinazolin-2-yl)ethyl]azanium.
| Compound Name | [(R)-(4-methoxyphenyl)-phenylmethyl]-[(1S)-1-(4-oxo-3H-quinazolin-2-yl)ethyl]azanium |
|---|---|
| PubChem CID | 135677079 |
| Molecular Formula | C24H24N3O2+ |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | [(R)-(4-methoxyphenyl)-phenylmethyl]-[(1S)-1-(4-oxo-3H-quinazolin-2-yl)ethyl]azanium |
| SMILES | COc1ccc([C@H]([NH2+][C@@H](C)c2nc3ccccc3c(=O)[nH]2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H23N3O2/c1-16(23-26-21-11-7-6-10-20(21)24(28)27-23)25-22(17-8-4-3-5-9-17)18-12-14-19(29-2)15-13-18/h3-16,22,25H,1-2H3,(H,26,27,28)/p+1/t16-,22+/m0/s1 |
| InChIKey | PCGVEKCPEMMSQT-KSFYIVLOSA-O |
| XLogP | 3.35 |
| TPSA | 71.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |