C23H23N3OS — CID 135751150
2-[(1S)-1-[[(S)-(4-ethylphenyl)-thiophen-2-ylmethyl]amino]ethyl]-3H-quinazolin-4-one (PubChem CID 135751150) has the molecular formula C23H23N3OS and a molecular weight of 389.52 g/mol. Its IUPAC name is 2-[(1S)-1-[[(S)-(4-ethylphenyl)-thiophen-2-ylmethyl]amino]ethyl]-3H-quinazolin-4-one.
| Compound Name | 2-[(1S)-1-[[(S)-(4-ethylphenyl)-thiophen-2-ylmethyl]amino]ethyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135751150 |
| Molecular Formula | C23H23N3OS |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | 2-[(1S)-1-[[(S)-(4-ethylphenyl)-thiophen-2-ylmethyl]amino]ethyl]-3H-quinazolin-4-one |
| SMILES | CCc1ccc([C@H](N[C@@H](C)c2nc3ccccc3c(=O)[nH]2)c2cccs2)cc1 |
| InChI | InChI=1S/C23H23N3OS/c1-3-16-10-12-17(13-11-16)21(20-9-6-14-28-20)24-15(2)22-25-19-8-5-4-7-18(19)23(27)26-22/h4-15,21,24H,3H2,1-2H3,(H,25,26,27)/t15-,21-/m0/s1 |
| InChIKey | JHNVADORRXPTIT-BTYIYWSLSA-N |
| XLogP | 4.99 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |