C26H28F2N6O3S — CID 130434952
N-[3-[(4S,5S,6R)-2-amino-6-[(E)-3-(dimethylamino)-3-oxoprop-1-enyl]-4-(fluoromethyl)-5,6-dimethyl-5H-1,3-thiazin-4-yl]-4-fluorophenyl]-5-prop-2-ynoxypyrazine-2-carboxamide (PubChem CID 130434952) has the molecular formula C26H28F2N6O3S and a molecular weight of 542.61 g/mol. Its IUPAC name is N-[3-[(4S,5S,6R)-2-amino-6-[(E)-3-(dimethylamino)-3-oxoprop-1-enyl]-4-(fluoromethyl)-5,6-dimethyl-5H-1,3-thiazin-4-yl]-4-fluorophenyl]-5-prop-2-ynoxypyrazine-2-carboxamide.
| Compound Name | N-[3-[(4S,5S,6R)-2-amino-6-[(E)-3-(dimethylamino)-3-oxoprop-1-enyl]-4-(fluoromethyl)-5,6-dimethyl-5H-1,3-thiazin-4-yl]-4-fluorophenyl]-5-prop-2-ynoxypyrazine-2-carboxamide |
|---|---|
| PubChem CID | 130434952 |
| Molecular Formula | C26H28F2N6O3S |
| Molecular Weight | 542.61 g/mol |
| Exact Mass | 542.19 |
| IUPAC Name | N-[3-[(4S,5S,6R)-2-amino-6-[(E)-3-(dimethylamino)-3-oxoprop-1-enyl]-4-(fluoromethyl)-5,6-dimethyl-5H-1,3-thiazin-4-yl]-4-fluorophenyl]-5-prop-2-ynoxypyrazine-2-carboxamide |
| SMILES | C#CCOc1cnc(C(=O)Nc2ccc(F)c([C@@]3(CF)N=C(N)S[C@](C)(/C=C/C(=O)N(C)C)[C@H]3C)c2)cn1 |
| InChI | InChI=1S/C26H28F2N6O3S/c1-6-11-37-21-14-30-20(13-31-21)23(36)32-17-7-8-19(28)18(12-17)26(15-27)16(2)25(3,38-24(29)33-26)10-9-22(35)34(4)5/h1,7-10,12-14,16H,11,15H2,2-5H3,(H2,29,33)(H,32,36)/b10-9+/t16-,25-,26+/m1/s1 |
| InChIKey | MNYWWKOBJDKZOY-OPUOMICPSA-N |
| XLogP | 3.15 |
| TPSA | 122.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.61 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|