C25H23F2N7O4S — CID 130435119
N-[3-[(4S,5S,6S)-2-amino-4-(fluoromethyl)-5,6-dimethyl-6-(1,3-oxazol-5-yl)-5H-1,3-thiazin-4-yl]-4-fluorophenyl]-5-(1,3-oxazol-2-ylmethoxy)pyrazine-2-carboxamide (PubChem CID 130435119) has the molecular formula C25H23F2N7O4S and a molecular weight of 555.57 g/mol. Its IUPAC name is N-[3-[(4S,5S,6S)-2-amino-4-(fluoromethyl)-5,6-dimethyl-6-(1,3-oxazol-5-yl)-5H-1,3-thiazin-4-yl]-4-fluorophenyl]-5-(1,3-oxazol-2-ylmethoxy)pyrazine-2-carboxamide.
| Compound Name | N-[3-[(4S,5S,6S)-2-amino-4-(fluoromethyl)-5,6-dimethyl-6-(1,3-oxazol-5-yl)-5H-1,3-thiazin-4-yl]-4-fluorophenyl]-5-(1,3-oxazol-2-ylmethoxy)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 130435119 |
| Molecular Formula | C25H23F2N7O4S |
| Molecular Weight | 555.57 g/mol |
| Exact Mass | 555.15 |
| IUPAC Name | N-[3-[(4S,5S,6S)-2-amino-4-(fluoromethyl)-5,6-dimethyl-6-(1,3-oxazol-5-yl)-5H-1,3-thiazin-4-yl]-4-fluorophenyl]-5-(1,3-oxazol-2-ylmethoxy)pyrazine-2-carboxamide |
| SMILES | C[C@H]1[C@@](CF)(c2cc(NC(=O)c3cnc(OCc4ncco4)cn3)ccc2F)N=C(N)S[C@]1(C)c1cnco1 |
| InChI | InChI=1S/C25H23F2N7O4S/c1-14-24(2,19-9-29-13-38-19)39-23(28)34-25(14,12-26)16-7-15(3-4-17(16)27)33-22(35)18-8-32-20(10-31-18)37-11-21-30-5-6-36-21/h3-10,13-14H,11-12H2,1-2H3,(H2,28,34)(H,33,35)/t14-,24+,25+/m1/s1 |
| InChIKey | WCQINKKLMMKWKO-CPXZRQHMSA-N |
| XLogP | 4.20 |
| TPSA | 154.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.57 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |