C25H26FN3O3 — CID 130439225
4-[(9aR)-8-[2-(4-methyl-1-oxo-3H-2-benzofuran-5-yl)ethyl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-3-yl]-2-fluorobenzonitrile (PubChem CID 130439225) has the molecular formula C25H26FN3O3 and a molecular weight of 435.50 g/mol. Its IUPAC name is 4-[(9aR)-8-[2-(4-methyl-1-oxo-3H-2-benzofuran-5-yl)ethyl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-3-yl]-2-fluorobenzonitrile.
| Compound Name | 4-[(9aR)-8-[2-(4-methyl-1-oxo-3H-2-benzofuran-5-yl)ethyl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-3-yl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 130439225 |
| Molecular Formula | C25H26FN3O3 |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | 4-[(9aR)-8-[2-(4-methyl-1-oxo-3H-2-benzofuran-5-yl)ethyl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-3-yl]-2-fluorobenzonitrile |
| SMILES | Cc1c(CCN2CCN3CC(c4ccc(C#N)c(F)c4)OC[C@H]3C2)ccc2c1COC2=O |
| InChI | InChI=1S/C25H26FN3O3/c1-16-17(4-5-21-22(16)15-32-25(21)30)6-7-28-8-9-29-13-24(31-14-20(29)12-28)18-2-3-19(11-27)23(26)10-18/h2-5,10,20,24H,6-9,12-15H2,1H3/t20-,24?/m1/s1 |
| InChIKey | BKXQJNYYBWLZPO-CGHJUBPDSA-N |
| XLogP | 2.98 |
| TPSA | 65.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |