C16H18N2O3S — CID 130441816
N-methyl-4-(naphthalen-2-ylsulfanyloxyamino)-5-oxopentanamide (PubChem CID 130441816) has the molecular formula C16H18N2O3S and a molecular weight of 318.40 g/mol. Its IUPAC name is N-methyl-4-(naphthalen-2-ylsulfanyloxyamino)-5-oxopentanamide.
| Compound Name | N-methyl-4-(naphthalen-2-ylsulfanyloxyamino)-5-oxopentanamide |
|---|---|
| PubChem CID | 130441816 |
| Molecular Formula | C16H18N2O3S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | N-methyl-4-(naphthalen-2-ylsulfanyloxyamino)-5-oxopentanamide |
| SMILES | CNC(=O)CCC(C=O)NOSc1ccc2ccccc2c1 |
| InChI | InChI=1S/C16H18N2O3S/c1-17-16(20)9-7-14(11-19)18-21-22-15-8-6-12-4-2-3-5-13(12)10-15/h2-6,8,10-11,14,18H,7,9H2,1H3,(H,17,20) |
| InChIKey | QNCBVUMGBSXKGL-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|