C16H25NO — CID 130442152
(1R)-N-butyl-N-[[(2E)-penta-2,4-dien-2-yl]oxymethyl]cyclohexa-2,4-dien-1-amine (PubChem CID 130442152) has the molecular formula C16H25NO and a molecular weight of 247.38 g/mol. Its IUPAC name is (1R)-N-butyl-N-[[(2E)-penta-2,4-dien-2-yl]oxymethyl]cyclohexa-2,4-dien-1-amine.
| Compound Name | (1R)-N-butyl-N-[[(2E)-penta-2,4-dien-2-yl]oxymethyl]cyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 130442152 |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | (1R)-N-butyl-N-[[(2E)-penta-2,4-dien-2-yl]oxymethyl]cyclohexa-2,4-dien-1-amine |
| SMILES | C=C/C=C(\C)OCN(CCCC)[C@H]1C=CC=CC1 |
| InChI | InChI=1S/C16H25NO/c1-4-6-13-17(14-18-15(3)10-5-2)16-11-8-7-9-12-16/h5,7-11,16H,2,4,6,12-14H2,1,3H3/b15-10+/t16-/m0/s1 |
| InChIKey | AIARAJWTFHPJGC-KMPOOHAWSA-N |
| XLogP | 4.04 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|