C20H17Cl2N3O — CID 130444893
4-[1-[(2,4-dichlorophenyl)methyl]indazol-6-yl]-3,6-dihydro-2H-pyridine-1-carbaldehyde (PubChem CID 130444893) has the molecular formula C20H17Cl2N3O and a molecular weight of 386.28 g/mol. Its IUPAC name is 4-[1-[(2,4-dichlorophenyl)methyl]indazol-6-yl]-3,6-dihydro-2H-pyridine-1-carbaldehyde.
| Compound Name | 4-[1-[(2,4-dichlorophenyl)methyl]indazol-6-yl]-3,6-dihydro-2H-pyridine-1-carbaldehyde |
|---|---|
| PubChem CID | 130444893 |
| Molecular Formula | C20H17Cl2N3O |
| Molecular Weight | 386.28 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | 4-[1-[(2,4-dichlorophenyl)methyl]indazol-6-yl]-3,6-dihydro-2H-pyridine-1-carbaldehyde |
| SMILES | O=CN1CC=C(c2ccc3cnn(Cc4ccc(Cl)cc4Cl)c3c2)CC1 |
| InChI | InChI=1S/C20H17Cl2N3O/c21-18-4-3-17(19(22)10-18)12-25-20-9-15(1-2-16(20)11-23-25)14-5-7-24(13-26)8-6-14/h1-5,9-11,13H,6-8,12H2 |
| InChIKey | JRMMBTFCKFQILM-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.28 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|