C21H15Cl2N3 — CID 3134332
1-[(2,4-dichlorophenyl)methyl]-3,5-diphenyl-1,2,4-triazole (PubChem CID 3134332) has the molecular formula C21H15Cl2N3 and a molecular weight of 380.28 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenyl)methyl]-3,5-diphenyl-1,2,4-triazole.
| Compound Name | 1-[(2,4-dichlorophenyl)methyl]-3,5-diphenyl-1,2,4-triazole |
|---|---|
| PubChem CID | 3134332 |
| Molecular Formula | C21H15Cl2N3 |
| Molecular Weight | 380.28 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | 1-[(2,4-dichlorophenyl)methyl]-3,5-diphenyl-1,2,4-triazole |
| SMILES | Clc1ccc(Cn2nc(-c3ccccc3)nc2-c2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C21H15Cl2N3/c22-18-12-11-17(19(23)13-18)14-26-21(16-9-5-2-6-10-16)24-20(25-26)15-7-3-1-4-8-15/h1-13H,14H2 |
| InChIKey | HFXAYCQUSGOEEY-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.28 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |