C16H12N2O — CID 130445412
4-(3-formylphenyl)-1,3-dihydroisoindole-2-carbonitrile (PubChem CID 130445412) has the molecular formula C16H12N2O and a molecular weight of 248.29 g/mol. Its IUPAC name is 4-(3-formylphenyl)-1,3-dihydroisoindole-2-carbonitrile.
| Compound Name | 4-(3-formylphenyl)-1,3-dihydroisoindole-2-carbonitrile |
|---|---|
| PubChem CID | 130445412 |
| Molecular Formula | C16H12N2O |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | 4-(3-formylphenyl)-1,3-dihydroisoindole-2-carbonitrile |
| SMILES | N#CN1Cc2cccc(-c3cccc(C=O)c3)c2C1 |
| InChI | InChI=1S/C16H12N2O/c17-11-18-8-14-5-2-6-15(16(14)9-18)13-4-1-3-12(7-13)10-19/h1-7,10H,8-9H2 |
| InChIKey | YTLGPVSBZDXLTI-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|