C26H33N3 — CID 130446247
(1Z)-1-[3-(4-benzylphenyl)-1-[(3S)-heptan-3-yl]-5-methylidenepyrazol-4-ylidene]ethanamine (PubChem CID 130446247) has the molecular formula C26H33N3 and a molecular weight of 387.57 g/mol. Its IUPAC name is (1Z)-1-[3-(4-benzylphenyl)-1-[(3S)-heptan-3-yl]-5-methylidenepyrazol-4-ylidene]ethanamine.
| Compound Name | (1Z)-1-[3-(4-benzylphenyl)-1-[(3S)-heptan-3-yl]-5-methylidenepyrazol-4-ylidene]ethanamine |
|---|---|
| PubChem CID | 130446247 |
| Molecular Formula | C26H33N3 |
| Molecular Weight | 387.57 g/mol |
| Exact Mass | 387.27 |
| IUPAC Name | (1Z)-1-[3-(4-benzylphenyl)-1-[(3S)-heptan-3-yl]-5-methylidenepyrazol-4-ylidene]ethanamine |
| SMILES | C=c1/c(=C(\C)N)c(-c2ccc(Cc3ccccc3)cc2)nn1[C@@H](CC)CCCC |
| InChI | InChI=1S/C26H33N3/c1-5-7-13-24(6-2)29-20(4)25(19(3)27)26(28-29)23-16-14-22(15-17-23)18-21-11-9-8-10-12-21/h8-12,14-17,24H,4-7,13,18,27H2,1-3H3/b25-19-/t24-/m0/s1 |
| InChIKey | UOGBDDVUPLMHRY-IAZSPCOPSA-N |
| XLogP | 4.78 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.57 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |