C27H33N5 — CID 155724782
3-(4-benzylphenyl)-1-nonan-3-ylpyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 155724782) has the molecular formula C27H33N5 and a molecular weight of 427.60 g/mol. Its IUPAC name is 3-(4-benzylphenyl)-1-nonan-3-ylpyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 3-(4-benzylphenyl)-1-nonan-3-ylpyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 155724782 |
| Molecular Formula | C27H33N5 |
| Molecular Weight | 427.60 g/mol |
| Exact Mass | 427.27 |
| IUPAC Name | 3-(4-benzylphenyl)-1-nonan-3-ylpyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | CCCCCCC(CC)n1nc(-c2ccc(Cc3ccccc3)cc2)c2c(N)ncnc21 |
| InChI | InChI=1S/C27H33N5/c1-3-5-6-10-13-23(4-2)32-27-24(26(28)29-19-30-27)25(31-32)22-16-14-21(15-17-22)18-20-11-8-7-9-12-20/h7-9,11-12,14-17,19,23H,3-6,10,13,18H2,1-2H3,(H2,28,29,30) |
| InChIKey | CITBIZHVRZXFDR-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.60 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|