C20H25N5O2 — CID 123599657
3-[4-(oxolan-3-yloxy)phenyl]-1-pentan-3-ylpyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 123599657) has the molecular formula C20H25N5O2 and a molecular weight of 367.45 g/mol. Its IUPAC name is 3-[4-(oxolan-3-yloxy)phenyl]-1-pentan-3-ylpyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 3-[4-(oxolan-3-yloxy)phenyl]-1-pentan-3-ylpyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 123599657 |
| Molecular Formula | C20H25N5O2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | 3-[4-(oxolan-3-yloxy)phenyl]-1-pentan-3-ylpyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | CCC(CC)n1nc(-c2ccc(OC3CCOC3)cc2)c2c(N)ncnc21 |
| InChI | InChI=1S/C20H25N5O2/c1-3-14(4-2)25-20-17(19(21)22-12-23-20)18(24-25)13-5-7-15(8-6-13)27-16-9-10-26-11-16/h5-8,12,14,16H,3-4,9-11H2,1-2H3,(H2,21,22,23) |
| InChIKey | FXPFEAOWWILHQI-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |