C20H23N5O — CID 171801921
1-[(2S)-butan-2-yl]-3-[4-[(2E)-penta-2,4-dien-2-yl]oxyphenyl]pyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 171801921) has the molecular formula C20H23N5O and a molecular weight of 349.44 g/mol. Its IUPAC name is 1-[(2S)-butan-2-yl]-3-[4-[(2E)-penta-2,4-dien-2-yl]oxyphenyl]pyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 1-[(2S)-butan-2-yl]-3-[4-[(2E)-penta-2,4-dien-2-yl]oxyphenyl]pyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 171801921 |
| Molecular Formula | C20H23N5O |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | 1-[(2S)-butan-2-yl]-3-[4-[(2E)-penta-2,4-dien-2-yl]oxyphenyl]pyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | C=C/C=C(\C)Oc1ccc(-c2nn([C@@H](C)CC)c3ncnc(N)c23)cc1 |
| InChI | InChI=1S/C20H23N5O/c1-5-7-14(4)26-16-10-8-15(9-11-16)18-17-19(21)22-12-23-20(17)25(24-18)13(3)6-2/h5,7-13H,1,6H2,2-4H3,(H2,21,22,23)/b14-7+/t13-/m0/s1 |
| InChIKey | LKKBQWBXGXGUAB-PZMUVPOTSA-N |
| XLogP | 4.52 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|