C25H28N6O2 — CID 89056498
(E)-N-[2-[4-amino-3-[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]oxyphenyl]pyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-N-methylbut-2-enamide (PubChem CID 89056498) has the molecular formula C25H28N6O2 and a molecular weight of 444.54 g/mol. Its IUPAC name is (E)-N-[2-[4-amino-3-[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]oxyphenyl]pyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-N-methylbut-2-enamide.
| Compound Name | (E)-N-[2-[4-amino-3-[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]oxyphenyl]pyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-N-methylbut-2-enamide |
|---|---|
| PubChem CID | 89056498 |
| Molecular Formula | C25H28N6O2 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | (E)-N-[2-[4-amino-3-[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]oxyphenyl]pyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-N-methylbut-2-enamide |
| SMILES | C=C/C=C(\C=C/C)Oc1ccc(-c2nn(CCN(C)C(=O)/C=C/C)c3ncnc(N)c23)cc1 |
| InChI | InChI=1S/C25H28N6O2/c1-5-8-19(9-6-2)33-20-13-11-18(12-14-20)23-22-24(26)27-17-28-25(22)31(29-23)16-15-30(4)21(32)10-7-3/h5-14,17H,1,15-16H2,2-4H3,(H2,26,27,28)/b9-6-,10-7+,19-8+ |
| InChIKey | AKCKJZGUQLIGLZ-JHXNIRLFSA-N |
| XLogP | 4.13 |
| TPSA | 99.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|