C27H35N6O2P — CID 131982961
N-[(2S)-2-[4-amino-3-[(2E,4Z,6E)-6-[(3E,5Z)-hepta-1,3,5-trien-4-yl]oxyocta-2,4,6-trien-3-yl]pyrazolo[3,4-d]pyrimidin-1-yl]-2-phosphanylethyl]-N-ethylprop-2-enamide (PubChem CID 131982961) has the molecular formula C27H35N6O2P and a molecular weight of 506.59 g/mol. Its IUPAC name is N-[(2S)-2-[4-amino-3-[(2E,4Z,6E)-6-[(3E,5Z)-hepta-1,3,5-trien-4-yl]oxyocta-2,4,6-trien-3-yl]pyrazolo[3,4-d]pyrimidin-1-yl]-2-phosphanylethyl]-N-ethylprop-2-enamide.
| Compound Name | N-[(2S)-2-[4-amino-3-[(2E,4Z,6E)-6-[(3E,5Z)-hepta-1,3,5-trien-4-yl]oxyocta-2,4,6-trien-3-yl]pyrazolo[3,4-d]pyrimidin-1-yl]-2-phosphanylethyl]-N-ethylprop-2-enamide |
|---|---|
| PubChem CID | 131982961 |
| Molecular Formula | C27H35N6O2P |
| Molecular Weight | 506.59 g/mol |
| Exact Mass | 506.26 |
| IUPAC Name | N-[(2S)-2-[4-amino-3-[(2E,4Z,6E)-6-[(3E,5Z)-hepta-1,3,5-trien-4-yl]oxyocta-2,4,6-trien-3-yl]pyrazolo[3,4-d]pyrimidin-1-yl]-2-phosphanylethyl]-N-ethylprop-2-enamide |
| SMILES | C=C/C=C(\C=C/C)OC(/C=C\C(=C/C)c1nn([C@@H](P)CN(CC)C(=O)C=C)c2ncnc(N)c12)=C/C |
| InChI | InChI=1S/C27H35N6O2P/c1-7-13-21(14-8-2)35-20(10-4)16-15-19(9-3)25-24-26(28)29-18-30-27(24)33(31-25)23(36)17-32(12-6)22(34)11-5/h7-11,13-16,18,23H,1,5,12,17,36H2,2-4,6H3,(H2,28,29,30)/b14-8-,16-15-,19-9+,20-10+,21-13+/t23-/m0/s1 |
| InChIKey | LBPOQOZSRFJBFY-CMUSSFKVSA-N |
| XLogP | 5.34 |
| TPSA | 99.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.59 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|