C16H19N5O — CID 145408612
(2E)-N-(9-propan-2-ylpurin-6-yl)-2-[(Z)-prop-1-enyl]penta-2,4-dienamide (PubChem CID 145408612) has the molecular formula C16H19N5O and a molecular weight of 297.36 g/mol. Its IUPAC name is (2E)-N-(9-propan-2-ylpurin-6-yl)-2-[(Z)-prop-1-enyl]penta-2,4-dienamide.
| Compound Name | (2E)-N-(9-propan-2-ylpurin-6-yl)-2-[(Z)-prop-1-enyl]penta-2,4-dienamide |
|---|---|
| PubChem CID | 145408612 |
| Molecular Formula | C16H19N5O |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | (2E)-N-(9-propan-2-ylpurin-6-yl)-2-[(Z)-prop-1-enyl]penta-2,4-dienamide |
| SMILES | C=C/C=C(\C=C/C)C(=O)Nc1ncnc2c1ncn2C(C)C |
| InChI | InChI=1S/C16H19N5O/c1-5-7-12(8-6-2)16(22)20-14-13-15(18-9-17-14)21(10-19-13)11(3)4/h5-11H,1H2,2-4H3,(H,17,18,20,22)/b8-6-,12-7+ |
| InChIKey | SPFNJWZUZLNIGN-LQNKLOEDSA-N |
| XLogP | 3.03 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|