C15H22N8O2 — CID 142627546
2-[6-[[4-(diaminomethylideneamino)cyclohexyl]amino]purin-9-yl]propanoic acid (PubChem CID 142627546) has the molecular formula C15H22N8O2 and a molecular weight of 346.40 g/mol. Its IUPAC name is 2-[6-[[4-(diaminomethylideneamino)cyclohexyl]amino]purin-9-yl]propanoic acid.
| Compound Name | 2-[6-[[4-(diaminomethylideneamino)cyclohexyl]amino]purin-9-yl]propanoic acid |
|---|---|
| PubChem CID | 142627546 |
| Molecular Formula | C15H22N8O2 |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 2-[6-[[4-(diaminomethylideneamino)cyclohexyl]amino]purin-9-yl]propanoic acid |
| SMILES | CC(C(=O)O)n1cnc2c(NC3CCC(N=C(N)N)CC3)ncnc21 |
| InChI | InChI=1S/C15H22N8O2/c1-8(14(24)25)23-7-20-11-12(18-6-19-13(11)23)21-9-2-4-10(5-3-9)22-15(16)17/h6-10H,2-5H2,1H3,(H,24,25)(H4,16,17,22)(H,18,19,21) |
| InChIKey | OXINGXWMIUAGHE-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 157.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.40 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|