C13H19ClN6O3 — CID 10641091
[(1S,2R,3S,4R)-4-[6-(cyclopropylamino)purin-9-yl]-2,3-dihydroxycyclopentyl]-hydroxyazanium chloride (PubChem CID 10641091) has the molecular formula C13H19ClN6O3 and a molecular weight of 342.79 g/mol. Its IUPAC name is [(1S,2R,3S,4R)-4-[6-(cyclopropylamino)purin-9-yl]-2,3-dihydroxycyclopentyl]-hydroxyazanium chloride.
| Compound Name | [(1S,2R,3S,4R)-4-[6-(cyclopropylamino)purin-9-yl]-2,3-dihydroxycyclopentyl]-hydroxyazanium chloride |
|---|---|
| PubChem CID | 10641091 |
| Molecular Formula | C13H19ClN6O3 |
| Molecular Weight | 342.79 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | [(1S,2R,3S,4R)-4-[6-(cyclopropylamino)purin-9-yl]-2,3-dihydroxycyclopentyl]-hydroxyazanium chloride |
| SMILES | O[NH2+][C@H]1C[C@@H](n2cnc3c(NC4CC4)ncnc32)[C@H](O)[C@@H]1O.[Cl-] |
| InChI | InChI=1S/C13H18N6O3.ClH/c20-10-7(18-22)3-8(11(10)21)19-5-16-9-12(17-6-1-2-6)14-4-15-13(9)19;/h4-8,10-11,18,20-22H,1-3H2,(H,14,15,17);1H/t7-,8+,10+,11-;/m0./s1 |
| InChIKey | CKAFCNVBTVMTDJ-MBODOHECSA-N |
| XLogP | -4.61 |
| TPSA | 132.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.79 |
| LogP ≤ 5 | -4.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|