C17H20N8O — CID 154783795
2-(6-aminopurin-9-yl)-1-(4-pyridin-4-ylpiperazin-1-yl)propan-1-one (PubChem CID 154783795) has the molecular formula C17H20N8O and a molecular weight of 352.40 g/mol. Its IUPAC name is 2-(6-aminopurin-9-yl)-1-(4-pyridin-4-ylpiperazin-1-yl)propan-1-one.
| Compound Name | 2-(6-aminopurin-9-yl)-1-(4-pyridin-4-ylpiperazin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 154783795 |
| Molecular Formula | C17H20N8O |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 2-(6-aminopurin-9-yl)-1-(4-pyridin-4-ylpiperazin-1-yl)propan-1-one |
| SMILES | CC(C(=O)N1CCN(c2ccncc2)CC1)n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C17H20N8O/c1-12(25-11-22-14-15(18)20-10-21-16(14)25)17(26)24-8-6-23(7-9-24)13-2-4-19-5-3-13/h2-5,10-12H,6-9H2,1H3,(H2,18,20,21) |
| InChIKey | FNXLYSUDLXCICA-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 106.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |