About methyl 2-[2-(6-aminopurin-9-yl)propanoylamino]-4,4-dimethylpentanoate
methyl 2-[2-(6-aminopurin-9-yl)propanoylamino]-4,4-dimethylpentanoate (PubChem CID 146107744) has the molecular formula C16H24N6O3
and a molecular weight of 348.41 g/mol. Its IUPAC name is methyl 2-[2-(6-aminopurin-9-yl)propanoylamino]-4,4-dimethylpentanoate.
Molecular Properties
| Compound Name | methyl 2-[2-(6-aminopurin-9-yl)propanoylamino]-4,4-dimethylpentanoate |
| PubChem CID | 146107744 |
| Molecular Formula | C16H24N6O3 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | methyl 2-[2-(6-aminopurin-9-yl)propanoylamino]-4,4-dimethylpentanoate |
| SMILES | COC(=O)C(CC(C)(C)C)NC(=O)C(C)n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C16H24N6O3/c1-9(22-8-20-11-12(17)18-7-19-13(11)22)14(23)21-10(15(24)25-5)6-16(2,3)4/h7-10H,6H2,1-5H3,(H,21,23)(H2,17,18,19) |
| InChIKey | YEPKLSFCYQTHDG-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 125.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze methyl 2-[2-(6-aminopurin-9-yl)propanoylamino]-4,4-dimethylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[2-(6-aminopurin-9-yl)propanoylamino]-4,4-dimethylpentanoate?
The IUPAC name of methyl 2-[2-(6-aminopurin-9-yl)propanoylamino]-4,4-dimethylpentanoate (CID 146107744) is methyl 2-[2-(6-aminopurin-9-yl)propanoylamino]-4,4-dimethylpentanoate.
What is the SMILES notation for methyl 2-[2-(6-aminopurin-9-yl)propanoylamino]-4,4-dimethylpentanoate?
The canonical SMILES for methyl 2-[2-(6-aminopurin-9-yl)propanoylamino]-4,4-dimethylpentanoate is COC(=O)C(CC(C)(C)C)NC(=O)C(C)n1cnc2c(N)ncnc21.
What is the InChIKey of methyl 2-[2-(6-aminopurin-9-yl)propanoylamino]-4,4-dimethylpentanoate?
The InChIKey is YEPKLSFCYQTHDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N6O3/c1-9(22-8-20-11-12(17)18-7-19-13(11)22)14(23)21-10(15(24)25-5)6-16(2,3)4/h7-10H,6H2,1-5H3,(H,21,23)(H2,17,18,19).
What are the key properties of methyl 2-[2-(6-aminopurin-9-yl)propanoylamino]-4,4-dimethylpentanoate?
methyl 2-[2-(6-aminopurin-9-yl)propanoylamino]-4,4-dimethylpentanoate has a molecular weight of 348.41 g/mol, XLogP of 1.06, 5 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[2-(6-aminopurin-9-yl)propanoylamino]-4,4-dimethylpentanoate is sourced from PubChem (CID 146107744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).