C21H28N8O — CID 138643447
1-propan-2-yl-4-[[(2Z,4Z)-6-[(9-propan-2-ylpurin-6-yl)amino]hexa-2,4-dienyl]amino]pyrimidin-2-one (PubChem CID 138643447) has the molecular formula C21H28N8O and a molecular weight of 408.51 g/mol. Its IUPAC name is 1-propan-2-yl-4-[[(2Z,4Z)-6-[(9-propan-2-ylpurin-6-yl)amino]hexa-2,4-dienyl]amino]pyrimidin-2-one.
| Compound Name | 1-propan-2-yl-4-[[(2Z,4Z)-6-[(9-propan-2-ylpurin-6-yl)amino]hexa-2,4-dienyl]amino]pyrimidin-2-one |
|---|---|
| PubChem CID | 138643447 |
| Molecular Formula | C21H28N8O |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | 1-propan-2-yl-4-[[(2Z,4Z)-6-[(9-propan-2-ylpurin-6-yl)amino]hexa-2,4-dienyl]amino]pyrimidin-2-one |
| SMILES | CC(C)n1ccc(NC/C=C\C=C/CNc2ncnc3c2ncn3C(C)C)nc1=O |
| InChI | InChI=1S/C21H28N8O/c1-15(2)28-12-9-17(27-21(28)30)22-10-7-5-6-8-11-23-19-18-20(25-13-24-19)29(14-26-18)16(3)4/h5-9,12-16H,10-11H2,1-4H3,(H,22,27,30)(H,23,24,25)/b7-5-,8-6- |
| InChIKey | DXOIIWIERIQHLJ-SFECMWDFSA-N |
| XLogP | 3.18 |
| TPSA | 102.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|