C44H51N13O2 — CID 158643822
2-(benzylamino)-9-propan-2-yl-1H-purin-6-one;4-(benzylamino)-1-propan-2-ylpyrimidin-2-one;N-benzyl-9-propan-2-ylpurin-6-amine (PubChem CID 158643822) has the molecular formula C44H51N13O2 and a molecular weight of 793.98 g/mol. Its IUPAC name is 2-(benzylamino)-9-propan-2-yl-1H-purin-6-one;4-(benzylamino)-1-propan-2-ylpyrimidin-2-one;N-benzyl-9-propan-2-ylpurin-6-amine.
| Compound Name | 2-(benzylamino)-9-propan-2-yl-1H-purin-6-one;4-(benzylamino)-1-propan-2-ylpyrimidin-2-one;N-benzyl-9-propan-2-ylpurin-6-amine |
|---|---|
| PubChem CID | 158643822 |
| Molecular Formula | C44H51N13O2 |
| Molecular Weight | 793.98 g/mol |
| Exact Mass | 793.43 |
| IUPAC Name | 2-(benzylamino)-9-propan-2-yl-1H-purin-6-one;4-(benzylamino)-1-propan-2-ylpyrimidin-2-one;N-benzyl-9-propan-2-ylpurin-6-amine |
| SMILES | CC(C)n1ccc(NCc2ccccc2)nc1=O.CC(C)n1cnc2c(=O)[nH]c(NCc3ccccc3)nc21.CC(C)n1cnc2c(NCc3ccccc3)ncnc21 |
| InChI | InChI=1S/C15H17N5O.C15H17N5.C14H17N3O/c1-10(2)20-9-17-12-13(20)18-15(19-14(12)21)16-8-11-6-4-3-5-7-11;1-11(2)20-10-19-13-14(17-9-18-15(13)20)16-8-12-6-4-3-5-7-12;1-11(2)17-9-8-13(16-14(17)18)15-10-12-6-4-3-5-7-12/h3-7,9-10H,8H2,1-2H3,(H2,16,18,19,21);3-7,9-11H,8H2,1-2H3,(H,16,17,18);3-9,11H,10H2,1-2H3,(H,15,16,18) |
| InChIKey | IASGSFNDZZIQAE-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 178.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.98 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |