C25H26N4O2 — CID 130447144
N-(2-methyl-1,3-dihydroisoindol-5-yl)-4-(1-phenylethylcarbamoylamino)benzamide (PubChem CID 130447144) has the molecular formula C25H26N4O2 and a molecular weight of 414.51 g/mol. Its IUPAC name is N-(2-methyl-1,3-dihydroisoindol-5-yl)-4-(1-phenylethylcarbamoylamino)benzamide.
| Compound Name | N-(2-methyl-1,3-dihydroisoindol-5-yl)-4-(1-phenylethylcarbamoylamino)benzamide |
|---|---|
| PubChem CID | 130447144 |
| Molecular Formula | C25H26N4O2 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | N-(2-methyl-1,3-dihydroisoindol-5-yl)-4-(1-phenylethylcarbamoylamino)benzamide |
| SMILES | CC(NC(=O)Nc1ccc(C(=O)Nc2ccc3c(c2)CN(C)C3)cc1)c1ccccc1 |
| InChI | InChI=1S/C25H26N4O2/c1-17(18-6-4-3-5-7-18)26-25(31)28-22-11-8-19(9-12-22)24(30)27-23-13-10-20-15-29(2)16-21(20)14-23/h3-14,17H,15-16H2,1-2H3,(H,27,30)(H2,26,28,31) |
| InChIKey | UYYMOJMQVXHEDW-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |