C11H13BrN4O — CID 130447864
5-bromo-7-(oxan-4-yl)pyrrolo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 130447864) has the molecular formula C11H13BrN4O and a molecular weight of 297.16 g/mol. Its IUPAC name is 5-bromo-7-(oxan-4-yl)pyrrolo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | 5-bromo-7-(oxan-4-yl)pyrrolo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 130447864 |
| Molecular Formula | C11H13BrN4O |
| Molecular Weight | 297.16 g/mol |
| Exact Mass | 296.03 |
| IUPAC Name | 5-bromo-7-(oxan-4-yl)pyrrolo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | Nc1ncnn2c(C3CCOCC3)cc(Br)c12 |
| InChI | InChI=1S/C11H13BrN4O/c12-8-5-9(7-1-3-17-4-2-7)16-10(8)11(13)14-6-15-16/h5-7H,1-4H2,(H2,13,14,15) |
| InChIKey | UNTWQYCOTWGYCR-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 65.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.16 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |