C24H36FNO — CID 13044955
2-[(Z)-1-fluorononadec-13-en-4,7-diynyl]-4,4-dimethyl-5H-1,3-oxazole (PubChem CID 13044955) has the molecular formula C24H36FNO and a molecular weight of 373.56 g/mol. Its IUPAC name is 2-[(Z)-1-fluorononadec-13-en-4,7-diynyl]-4,4-dimethyl-5H-1,3-oxazole.
| Compound Name | 2-[(Z)-1-fluorononadec-13-en-4,7-diynyl]-4,4-dimethyl-5H-1,3-oxazole |
|---|---|
| PubChem CID | 13044955 |
| Molecular Formula | C24H36FNO |
| Molecular Weight | 373.56 g/mol |
| Exact Mass | 373.28 |
| IUPAC Name | 2-[(Z)-1-fluorononadec-13-en-4,7-diynyl]-4,4-dimethyl-5H-1,3-oxazole |
| SMILES | CCCCC/C=C\CCCCC#CCC#CCCC(F)C1=NC(C)(C)CO1 |
| InChI | InChI=1S/C24H36FNO/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-22(25)23-26-24(2,3)21-27-23/h8-9,22H,4-7,10-13,16,19-21H2,1-3H3/b9-8- |
| InChIKey | SEZCGGIGLLQPGO-HJWRWDBZSA-N |
| XLogP | 6.41 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.56 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|