C15H15ClFN3OS — CID 130449974
N-(3-chloro-4-fluorophenyl)-2-(propan-2-ylsulfanylamino)pyridine-4-carboxamide (PubChem CID 130449974) has the molecular formula C15H15ClFN3OS and a molecular weight of 339.82 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-2-(propan-2-ylsulfanylamino)pyridine-4-carboxamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-2-(propan-2-ylsulfanylamino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 130449974 |
| Molecular Formula | C15H15ClFN3OS |
| Molecular Weight | 339.82 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-2-(propan-2-ylsulfanylamino)pyridine-4-carboxamide |
| SMILES | CC(C)SNc1cc(C(=O)Nc2ccc(F)c(Cl)c2)ccn1 |
| InChI | InChI=1S/C15H15ClFN3OS/c1-9(2)22-20-14-7-10(5-6-18-14)15(21)19-11-3-4-13(17)12(16)8-11/h3-9H,1-2H3,(H,18,20)(H,19,21) |
| InChIKey | HTYUTIVFZMIRHQ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.82 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|