C16H15ClFN3O3S — CID 121380288
N-(3-chloro-4-fluorophenyl)-2-(cyclopropylmethylsulfonylamino)pyridine-4-carboxamide (PubChem CID 121380288) has the molecular formula C16H15ClFN3O3S and a molecular weight of 383.83 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-2-(cyclopropylmethylsulfonylamino)pyridine-4-carboxamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-2-(cyclopropylmethylsulfonylamino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 121380288 |
| Molecular Formula | C16H15ClFN3O3S |
| Molecular Weight | 383.83 g/mol |
| Exact Mass | 383.05 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-2-(cyclopropylmethylsulfonylamino)pyridine-4-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(Cl)c1)c1ccnc(NS(=O)(=O)CC2CC2)c1 |
| InChI | InChI=1S/C16H15ClFN3O3S/c17-13-8-12(3-4-14(13)18)20-16(22)11-5-6-19-15(7-11)21-25(23,24)9-10-1-2-10/h3-8,10H,1-2,9H2,(H,19,21)(H,20,22) |
| InChIKey | OBDKURAUOLIGFD-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.83 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |