C27H19N3O4 — CID 130450296
11-(2-methylphenyl)-5-(2-nitrophenyl)benzo[c][1,5]benzodiazocine-6,12-dione (PubChem CID 130450296) has the molecular formula C27H19N3O4 and a molecular weight of 449.47 g/mol. Its IUPAC name is 11-(2-methylphenyl)-5-(2-nitrophenyl)benzo[c][1,5]benzodiazocine-6,12-dione.
| Compound Name | 11-(2-methylphenyl)-5-(2-nitrophenyl)benzo[c][1,5]benzodiazocine-6,12-dione |
|---|---|
| PubChem CID | 130450296 |
| Molecular Formula | C27H19N3O4 |
| Molecular Weight | 449.47 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | 11-(2-methylphenyl)-5-(2-nitrophenyl)benzo[c][1,5]benzodiazocine-6,12-dione |
| SMILES | Cc1ccccc1N1C(=O)c2ccccc2N(c2ccccc2[N+](=O)[O-])C(=O)c2ccccc21 |
| InChI | InChI=1S/C27H19N3O4/c1-18-10-2-5-13-21(18)28-22-14-6-3-11-19(22)27(32)29(23-15-7-4-12-20(23)26(28)31)24-16-8-9-17-25(24)30(33)34/h2-17H,1H3 |
| InChIKey | DLBYAKMIIJDMKL-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.47 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|