C18H13N5O — CID 130454392
6-[2-(1-cyanopyrrolidin-2-yl)-1,3-benzoxazol-6-yl]pyridine-2-carbonitrile (PubChem CID 130454392) has the molecular formula C18H13N5O and a molecular weight of 315.34 g/mol. Its IUPAC name is 6-[2-(1-cyanopyrrolidin-2-yl)-1,3-benzoxazol-6-yl]pyridine-2-carbonitrile.
| Compound Name | 6-[2-(1-cyanopyrrolidin-2-yl)-1,3-benzoxazol-6-yl]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 130454392 |
| Molecular Formula | C18H13N5O |
| Molecular Weight | 315.34 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 6-[2-(1-cyanopyrrolidin-2-yl)-1,3-benzoxazol-6-yl]pyridine-2-carbonitrile |
| SMILES | N#Cc1cccc(-c2ccc3nc(C4CCCN4C#N)oc3c2)n1 |
| InChI | InChI=1S/C18H13N5O/c19-10-13-3-1-4-14(21-13)12-6-7-15-17(9-12)24-18(22-15)16-5-2-8-23(16)11-20/h1,3-4,6-7,9,16H,2,5,8H2 |
| InChIKey | SZHDMYNPEVEWAR-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 89.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.34 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|