C19H14N6O — CID 155211397
2-[5-[2-(3-cyanophenyl)-4-pyridinyl]-1,2,4-oxadiazol-3-yl]pyrrolidine-1-carbonitrile (PubChem CID 155211397) has the molecular formula C19H14N6O and a molecular weight of 342.36 g/mol. Its IUPAC name is 2-[5-[2-(3-cyanophenyl)-4-pyridinyl]-1,2,4-oxadiazol-3-yl]pyrrolidine-1-carbonitrile.
| Compound Name | 2-[5-[2-(3-cyanophenyl)-4-pyridinyl]-1,2,4-oxadiazol-3-yl]pyrrolidine-1-carbonitrile |
|---|---|
| PubChem CID | 155211397 |
| Molecular Formula | C19H14N6O |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 2-[5-[2-(3-cyanophenyl)-4-pyridinyl]-1,2,4-oxadiazol-3-yl]pyrrolidine-1-carbonitrile |
| SMILES | N#Cc1cccc(-c2cc(-c3nc(C4CCCN4C#N)no3)ccn2)c1 |
| InChI | InChI=1S/C19H14N6O/c20-11-13-3-1-4-14(9-13)16-10-15(6-7-22-16)19-23-18(24-26-19)17-5-2-8-25(17)12-21/h1,3-4,6-7,9-10,17H,2,5,8H2 |
| InChIKey | DXJFNBXEXCOKRM-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 102.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|