C20H17N5 — CID 175744657
2-[4-(3-cyanophenyl)-1H-benzimidazol-2-yl]piperidine-1-carbonitrile (PubChem CID 175744657) has the molecular formula C20H17N5 and a molecular weight of 327.39 g/mol. Its IUPAC name is 2-[4-(3-cyanophenyl)-1H-benzimidazol-2-yl]piperidine-1-carbonitrile.
| Compound Name | 2-[4-(3-cyanophenyl)-1H-benzimidazol-2-yl]piperidine-1-carbonitrile |
|---|---|
| PubChem CID | 175744657 |
| Molecular Formula | C20H17N5 |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 2-[4-(3-cyanophenyl)-1H-benzimidazol-2-yl]piperidine-1-carbonitrile |
| SMILES | N#Cc1cccc(-c2cccc3[nH]c(C4CCCCN4C#N)nc23)c1 |
| InChI | InChI=1S/C20H17N5/c21-12-14-5-3-6-15(11-14)16-7-4-8-17-19(16)24-20(23-17)18-9-1-2-10-25(18)13-22/h3-8,11,18H,1-2,9-10H2,(H,23,24) |
| InChIKey | BIRNWAMBLXJLJK-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 79.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|