C20H29NO6S2 — CID 130460929
(3S)-1-[4-(cyclohexylmethylsulfonyl)phenyl]sulfonyl-3-methylpiperidine-3-carboxylic acid (PubChem CID 130460929) has the molecular formula C20H29NO6S2 and a molecular weight of 443.59 g/mol. Its IUPAC name is (3S)-1-[4-(cyclohexylmethylsulfonyl)phenyl]sulfonyl-3-methylpiperidine-3-carboxylic acid.
| Compound Name | (3S)-1-[4-(cyclohexylmethylsulfonyl)phenyl]sulfonyl-3-methylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 130460929 |
| Molecular Formula | C20H29NO6S2 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | (3S)-1-[4-(cyclohexylmethylsulfonyl)phenyl]sulfonyl-3-methylpiperidine-3-carboxylic acid |
| SMILES | C[C@]1(C(=O)O)CCCN(S(=O)(=O)c2ccc(S(=O)(=O)CC3CCCCC3)cc2)C1 |
| InChI | InChI=1S/C20H29NO6S2/c1-20(19(22)23)12-5-13-21(15-20)29(26,27)18-10-8-17(9-11-18)28(24,25)14-16-6-3-2-4-7-16/h8-11,16H,2-7,12-15H2,1H3,(H,22,23)/t20-/m0/s1 |
| InChIKey | LJEJMEBCLZZHDA-FQEVSTJZSA-N |
| XLogP | 2.92 |
| TPSA | 108.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |