C10H14N2O4S — CID 55164804
3-methyl-1-(1H-pyrrol-3-ylsulfonyl)pyrrolidine-3-carboxylic acid (PubChem CID 55164804) has the molecular formula C10H14N2O4S and a molecular weight of 258.30 g/mol. Its IUPAC name is 3-methyl-1-(1H-pyrrol-3-ylsulfonyl)pyrrolidine-3-carboxylic acid.
| Compound Name | 3-methyl-1-(1H-pyrrol-3-ylsulfonyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 55164804 |
| Molecular Formula | C10H14N2O4S |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 3-methyl-1-(1H-pyrrol-3-ylsulfonyl)pyrrolidine-3-carboxylic acid |
| SMILES | CC1(C(=O)O)CCN(S(=O)(=O)c2cc[nH]c2)C1 |
| InChI | InChI=1S/C10H14N2O4S/c1-10(9(13)14)3-5-12(7-10)17(15,16)8-2-4-11-6-8/h2,4,6,11H,3,5,7H2,1H3,(H,13,14) |
| InChIKey | XMKCMVCJZVBVKB-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 90.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |